C14H9F3N2O3 — CID 115109545
1-methyl-5-[6-(trifluoromethyl)-1-benzofuran-2-yl]pyrazole-4-carboxylic acid (PubChem CID 115109545) has the molecular formula C14H9F3N2O3 and a molecular weight of 310.23 g/mol. Its IUPAC name is 1-methyl-5-[6-(trifluoromethyl)-1-benzofuran-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-[6-(trifluoromethyl)-1-benzofuran-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115109545 |
| Molecular Formula | C14H9F3N2O3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 1-methyl-5-[6-(trifluoromethyl)-1-benzofuran-2-yl]pyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1-c1cc2ccc(C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C14H9F3N2O3/c1-19-12(9(6-18-19)13(20)21)11-4-7-2-3-8(14(15,16)17)5-10(7)22-11/h2-6H,1H3,(H,20,21) |
| InChIKey | XGABSYKQEMSATG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |