C13H9F3N2O4 — CID 117218974
1-methyl-5-[3-(trifluoromethyl)phenoxy]carbonylpyrazole-4-carboxylic acid (PubChem CID 117218974) has the molecular formula C13H9F3N2O4 and a molecular weight of 314.22 g/mol. Its IUPAC name is 1-methyl-5-[3-(trifluoromethyl)phenoxy]carbonylpyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-5-[3-(trifluoromethyl)phenoxy]carbonylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117218974 |
| Molecular Formula | C13H9F3N2O4 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-methyl-5-[3-(trifluoromethyl)phenoxy]carbonylpyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1C(=O)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F3N2O4/c1-18-10(9(6-17-18)11(19)20)12(21)22-8-4-2-3-7(5-8)13(14,15)16/h2-6H,1H3,(H,19,20) |
| InChIKey | FZMSPHFHMKFUJN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|