C19H17IN2O4 — CID 11510987
(2R)-3-(7-iodo-1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 11510987) has the molecular formula C19H17IN2O4 and a molecular weight of 464.26 g/mol. Its IUPAC name is (2R)-3-(7-iodo-1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2R)-3-(7-iodo-1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 11510987 |
| Molecular Formula | C19H17IN2O4 |
| Molecular Weight | 464.26 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | (2R)-3-(7-iodo-1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(N[C@H](Cc1c[nH]c2c(I)cccc12)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H17IN2O4/c20-15-8-4-7-14-13(10-21-17(14)15)9-16(18(23)24)22-19(25)26-11-12-5-2-1-3-6-12/h1-8,10,16,21H,9,11H2,(H,22,25)(H,23,24)/t16-/m1/s1 |
| InChIKey | RTNKWTCRQILWTK-MRXNPFEDSA-N |
| XLogP | 3.69 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|