C26H24N2O5 — CID 94021274
(2R)-2-(phenylmethoxycarbonylamino)-3-(7-phenylmethoxy-1H-indol-3-yl)propanoic acid (PubChem CID 94021274) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is (2R)-2-(phenylmethoxycarbonylamino)-3-(7-phenylmethoxy-1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-(phenylmethoxycarbonylamino)-3-(7-phenylmethoxy-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 94021274 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (2R)-2-(phenylmethoxycarbonylamino)-3-(7-phenylmethoxy-1H-indol-3-yl)propanoic acid |
| SMILES | O=C(N[C@H](Cc1c[nH]c2c(OCc3ccccc3)cccc12)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C26H24N2O5/c29-25(30)22(28-26(31)33-17-19-10-5-2-6-11-19)14-20-15-27-24-21(20)12-7-13-23(24)32-16-18-8-3-1-4-9-18/h1-13,15,22,27H,14,16-17H2,(H,28,31)(H,29,30)/t22-/m1/s1 |
| InChIKey | LRMWZRPTFPTVEO-JOCHJYFZSA-N |
| XLogP | 4.67 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |