C25H31N3O4 — CID 139809915
benzyl N-[(2R)-1-[7-[2-(diethylamino)-2-oxoethoxy]-1H-indol-3-yl]propan-2-yl]carbamate (PubChem CID 139809915) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[7-[2-(diethylamino)-2-oxoethoxy]-1H-indol-3-yl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[7-[2-(diethylamino)-2-oxoethoxy]-1H-indol-3-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139809915 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | benzyl N-[(2R)-1-[7-[2-(diethylamino)-2-oxoethoxy]-1H-indol-3-yl]propan-2-yl]carbamate |
| SMILES | CCN(CC)C(=O)COc1cccc2c(C[C@@H](C)NC(=O)OCc3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C25H31N3O4/c1-4-28(5-2)23(29)17-31-22-13-9-12-21-20(15-26-24(21)22)14-18(3)27-25(30)32-16-19-10-7-6-8-11-19/h6-13,15,18,26H,4-5,14,16-17H2,1-3H3,(H,27,30)/t18-/m1/s1 |
| InChIKey | FRDKDQYSDYZNSJ-GOSISDBHSA-N |
| XLogP | 4.27 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |