C17H25N3O2 — CID 139809913
2-[[3-[(2S)-2-aminopropyl]-1H-indol-7-yl]oxy]-N,N-diethylacetamide (PubChem CID 139809913) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[[3-[(2S)-2-aminopropyl]-1H-indol-7-yl]oxy]-N,N-diethylacetamide.
| Compound Name | 2-[[3-[(2S)-2-aminopropyl]-1H-indol-7-yl]oxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 139809913 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[[3-[(2S)-2-aminopropyl]-1H-indol-7-yl]oxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1cccc2c(C[C@H](C)N)c[nH]c12 |
| InChI | InChI=1S/C17H25N3O2/c1-4-20(5-2)16(21)11-22-15-8-6-7-14-13(9-12(3)18)10-19-17(14)15/h6-8,10,12,19H,4-5,9,11,18H2,1-3H3/t12-/m0/s1 |
| InChIKey | IJLIDEAXTZUTER-LBPRGKRZSA-N |
| XLogP | 2.30 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |