C15H16N2O3S2 — CID 71420491
[3-[(2R)-2-aminopropyl]-1H-indol-7-yl] thiophene-2-sulfonate (PubChem CID 71420491) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is [3-[(2R)-2-aminopropyl]-1H-indol-7-yl] thiophene-2-sulfonate.
| Compound Name | [3-[(2R)-2-aminopropyl]-1H-indol-7-yl] thiophene-2-sulfonate |
|---|---|
| PubChem CID | 71420491 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [3-[(2R)-2-aminopropyl]-1H-indol-7-yl] thiophene-2-sulfonate |
| SMILES | C[C@@H](N)Cc1c[nH]c2c(OS(=O)(=O)c3cccs3)cccc12 |
| InChI | InChI=1S/C15H16N2O3S2/c1-10(16)8-11-9-17-15-12(11)4-2-5-13(15)20-22(18,19)14-6-3-7-21-14/h2-7,9-10,17H,8,16H2,1H3/t10-/m1/s1 |
| InChIKey | KZYFCPWGLOVVCS-SNVBAGLBSA-N |
| XLogP | 2.89 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|