(2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate

C14H14O4S2 — CID 26948956

IUPAC(2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate
SMILESCC1(C)Cc2cccc(OS(=O)(=O)c3cccs3)c2O1
InChIInChI=1S/C14H14O4S2/c1-14(2)9-10-5-3-6-11(13(10)17-14)18-20(15,16)12-7-4-8-19-12/h3-8H,9H2,1-2H3
InChIKeyXTTLSLLMTQVBPL-UHFFFAOYSA-N
MW310.40 g/mol
LogP3.23
Rot. Bonds3

About (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate

(2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate (PubChem CID 26948956) has the molecular formula C14H14O4S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate.

Molecular Properties

Compound Name(2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate
PubChem CID26948956
Molecular FormulaC14H14O4S2
Molecular Weight310.40 g/mol
Exact Mass310.03
IUPAC Name(2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate
SMILESCC1(C)Cc2cccc(OS(=O)(=O)c3cccs3)c2O1
InChIInChI=1S/C14H14O4S2/c1-14(2)9-10-5-3-6-11(13(10)17-14)18-20(15,16)12-7-4-8-19-12/h3-8H,9H2,1-2H3
InChIKeyXTTLSLLMTQVBPL-UHFFFAOYSA-N
XLogP3.23
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.40
LogP ≤ 53.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate?
The IUPAC name of (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate (CID 26948956) is (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate.
What is the SMILES notation for (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate?
The canonical SMILES for (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate is CC1(C)Cc2cccc(OS(=O)(=O)c3cccs3)c2O1.
What is the InChIKey of (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate?
The InChIKey is XTTLSLLMTQVBPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S2/c1-14(2)9-10-5-3-6-11(13(10)17-14)18-20(15,16)12-7-4-8-19-12/h3-8H,9H2,1-2H3.
What are the key properties of (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate?
(2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate has a molecular weight of 310.40 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate is sourced from PubChem (CID 26948956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).