C14H14O4S2 — CID 26948956
(2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate (PubChem CID 26948956) has the molecular formula C14H14O4S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate |
|---|---|
| PubChem CID | 26948956 |
| Molecular Formula | C14H14O4S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) thiophene-2-sulfonate |
| SMILES | CC1(C)Cc2cccc(OS(=O)(=O)c3cccs3)c2O1 |
| InChI | InChI=1S/C14H14O4S2/c1-14(2)9-10-5-3-6-11(13(10)17-14)18-20(15,16)12-7-4-8-19-12/h3-8H,9H2,1-2H3 |
| InChIKey | XTTLSLLMTQVBPL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|