About (2-morpholin-4-ylphenyl) thiophene-2-sulfonate
(2-morpholin-4-ylphenyl) thiophene-2-sulfonate (PubChem CID 2813111) has the molecular formula C14H15NO4S2
and a molecular weight of 325.41 g/mol. Its IUPAC name is (2-morpholin-4-ylphenyl) thiophene-2-sulfonate.
Molecular Properties
| Compound Name | (2-morpholin-4-ylphenyl) thiophene-2-sulfonate |
| PubChem CID | 2813111 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (2-morpholin-4-ylphenyl) thiophene-2-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1N1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C14H15NO4S2/c16-21(17,14-6-3-11-20-14)19-13-5-2-1-4-12(13)15-7-9-18-10-8-15/h1-6,11H,7-10H2 |
| InChIKey | PEMULPNZFGHOGQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-morpholin-4-ylphenyl) thiophene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-morpholin-4-ylphenyl) thiophene-2-sulfonate?
The IUPAC name of (2-morpholin-4-ylphenyl) thiophene-2-sulfonate (CID 2813111) is (2-morpholin-4-ylphenyl) thiophene-2-sulfonate.
What is the SMILES notation for (2-morpholin-4-ylphenyl) thiophene-2-sulfonate?
The canonical SMILES for (2-morpholin-4-ylphenyl) thiophene-2-sulfonate is O=S(=O)(Oc1ccccc1N1CCOCC1)c1cccs1.
What is the InChIKey of (2-morpholin-4-ylphenyl) thiophene-2-sulfonate?
The InChIKey is PEMULPNZFGHOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4S2/c16-21(17,14-6-3-11-20-14)19-13-5-2-1-4-12(13)15-7-9-18-10-8-15/h1-6,11H,7-10H2.
What are the key properties of (2-morpholin-4-ylphenyl) thiophene-2-sulfonate?
(2-morpholin-4-ylphenyl) thiophene-2-sulfonate has a molecular weight of 325.41 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-morpholin-4-ylphenyl) thiophene-2-sulfonate is sourced from PubChem (CID 2813111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).