C14H13Cl2NO4S2 — CID 2813106
(2-morpholin-4-ylphenyl) 2,5-dichlorothiophene-3-sulfonate (PubChem CID 2813106) has the molecular formula C14H13Cl2NO4S2 and a molecular weight of 394.30 g/mol. Its IUPAC name is (2-morpholin-4-ylphenyl) 2,5-dichlorothiophene-3-sulfonate.
| Compound Name | (2-morpholin-4-ylphenyl) 2,5-dichlorothiophene-3-sulfonate |
|---|---|
| PubChem CID | 2813106 |
| Molecular Formula | C14H13Cl2NO4S2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | (2-morpholin-4-ylphenyl) 2,5-dichlorothiophene-3-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1N1CCOCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H13Cl2NO4S2/c15-13-9-12(14(16)22-13)23(18,19)21-11-4-2-1-3-10(11)17-5-7-20-8-6-17/h1-4,9H,5-8H2 |
| InChIKey | NBWDQSRXPVUPFK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|