C10H12Cl2N2O3S3 — CID 134095325
methyl (4Z)-N-(2,5-dichlorothiophen-3-yl)sulfonylmorpholine-4-carboximidothioate (PubChem CID 134095325) has the molecular formula C10H12Cl2N2O3S3 and a molecular weight of 375.32 g/mol. Its IUPAC name is methyl (4Z)-N-(2,5-dichlorothiophen-3-yl)sulfonylmorpholine-4-carboximidothioate.
| Compound Name | methyl (4Z)-N-(2,5-dichlorothiophen-3-yl)sulfonylmorpholine-4-carboximidothioate |
|---|---|
| PubChem CID | 134095325 |
| Molecular Formula | C10H12Cl2N2O3S3 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | methyl (4Z)-N-(2,5-dichlorothiophen-3-yl)sulfonylmorpholine-4-carboximidothioate |
| SMILES | CS/C(=N\S(=O)(=O)c1cc(Cl)sc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C10H12Cl2N2O3S3/c1-18-10(14-2-4-17-5-3-14)13-20(15,16)7-6-8(11)19-9(7)12/h6H,2-5H2,1H3/b13-10- |
| InChIKey | SNZKVUTWADPJFQ-RAXLEYEMSA-N |
| XLogP | 2.79 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|