C11H14Cl2N2O4S2 — CID 136530582
N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-ethylmorpholine-3-carboxamide (PubChem CID 136530582) has the molecular formula C11H14Cl2N2O4S2 and a molecular weight of 373.28 g/mol. Its IUPAC name is N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-ethylmorpholine-3-carboxamide.
| Compound Name | N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-ethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 136530582 |
| Molecular Formula | C11H14Cl2N2O4S2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | N-(2,5-dichlorothiophen-3-yl)sulfonyl-4-ethylmorpholine-3-carboxamide |
| SMILES | CCN1CCOCC1C(=O)NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O4S2/c1-2-15-3-4-19-6-7(15)11(16)14-21(17,18)8-5-9(12)20-10(8)13/h5,7H,2-4,6H2,1H3,(H,14,16) |
| InChIKey | GYJLUBVUUGSENK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |