C11H20N2O4 — CID 167837851
4-ethyl-N-[(3R,4S)-4-hydroxyoxolan-3-yl]morpholine-3-carboxamide (PubChem CID 167837851) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-ethyl-N-[(3R,4S)-4-hydroxyoxolan-3-yl]morpholine-3-carboxamide.
| Compound Name | 4-ethyl-N-[(3R,4S)-4-hydroxyoxolan-3-yl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 167837851 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 4-ethyl-N-[(3R,4S)-4-hydroxyoxolan-3-yl]morpholine-3-carboxamide |
| SMILES | CCN1CCOCC1C(=O)N[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C11H20N2O4/c1-2-13-3-4-16-6-9(13)11(15)12-8-5-17-7-10(8)14/h8-10,14H,2-7H2,1H3,(H,12,15)/t8-,9?,10-/m1/s1 |
| InChIKey | AFIUREWJAQJXOQ-RCAUJQPQSA-N |
| XLogP | -1.42 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |