C10H16N2O3 — CID 83103250
N-cyclopropyl-4-(2-oxoethyl)morpholine-3-carboxamide (PubChem CID 83103250) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-cyclopropyl-4-(2-oxoethyl)morpholine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-(2-oxoethyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83103250 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | N-cyclopropyl-4-(2-oxoethyl)morpholine-3-carboxamide |
| SMILES | O=CCN1CCOCC1C(=O)NC1CC1 |
| InChI | InChI=1S/C10H16N2O3/c13-5-3-12-4-6-15-7-9(12)10(14)11-8-1-2-8/h5,8-9H,1-4,6-7H2,(H,11,14) |
| InChIKey | MDBZQXXLDPYXRX-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|