C13H18ClN3O2S — CID 83103828
4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-cyclopropylmorpholine-3-carboxamide (PubChem CID 83103828) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is 4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-cyclopropylmorpholine-3-carboxamide.
| Compound Name | 4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-cyclopropylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83103828 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-cyclopropylmorpholine-3-carboxamide |
| SMILES | O=C(NC1CC1)C1COCCN1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H18ClN3O2S/c14-5-10-8-20-12(15-10)6-17-3-4-19-7-11(17)13(18)16-9-1-2-9/h8-9,11H,1-7H2,(H,16,18) |
| InChIKey | SBIMJDQYHRMODW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|