C7H13BF3KN2O2 — CID 83104353
potassium trifluoro-[[3-(methylcarbamoyl)morpholin-4-yl]methyl]boranuide (PubChem CID 83104353) has the molecular formula C7H13BF3KN2O2 and a molecular weight of 264.10 g/mol. Its IUPAC name is potassium trifluoro-[[3-(methylcarbamoyl)morpholin-4-yl]methyl]boranuide.
| Compound Name | potassium trifluoro-[[3-(methylcarbamoyl)morpholin-4-yl]methyl]boranuide |
|---|---|
| PubChem CID | 83104353 |
| Molecular Formula | C7H13BF3KN2O2 |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | potassium trifluoro-[[3-(methylcarbamoyl)morpholin-4-yl]methyl]boranuide |
| SMILES | CNC(=O)C1COCCN1C[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C7H13BF3N2O2.K/c1-12-7(14)6-4-15-3-2-13(6)5-8(9,10)11;/h6H,2-5H2,1H3,(H,12,14);/q-1;+1 |
| InChIKey | AUPPWLLBHKRCTG-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|