C9H17BF3KN2O2 — CID 83104637
potassium trifluoro-[[3-(propan-2-ylcarbamoyl)morpholin-4-yl]methyl]boranuide (PubChem CID 83104637) has the molecular formula C9H17BF3KN2O2 and a molecular weight of 292.15 g/mol. Its IUPAC name is potassium trifluoro-[[3-(propan-2-ylcarbamoyl)morpholin-4-yl]methyl]boranuide.
| Compound Name | potassium trifluoro-[[3-(propan-2-ylcarbamoyl)morpholin-4-yl]methyl]boranuide |
|---|---|
| PubChem CID | 83104637 |
| Molecular Formula | C9H17BF3KN2O2 |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | potassium trifluoro-[[3-(propan-2-ylcarbamoyl)morpholin-4-yl]methyl]boranuide |
| SMILES | CC(C)NC(=O)C1COCCN1C[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C9H17BF3N2O2.K/c1-7(2)14-9(16)8-5-17-4-3-15(8)6-10(11,12)13;/h7-8H,3-6H2,1-2H3,(H,14,16);/q-1;+1 |
| InChIKey | NNQKKXYJERVTLI-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|