C14H24N2O4 — CID 104751051
4-[2-oxo-2-(oxolan-3-yl)ethyl]-N-propan-2-ylmorpholine-3-carboxamide (PubChem CID 104751051) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[2-oxo-2-(oxolan-3-yl)ethyl]-N-propan-2-ylmorpholine-3-carboxamide.
| Compound Name | 4-[2-oxo-2-(oxolan-3-yl)ethyl]-N-propan-2-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 104751051 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-[2-oxo-2-(oxolan-3-yl)ethyl]-N-propan-2-ylmorpholine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1COCCN1CC(=O)C1CCOC1 |
| InChI | InChI=1S/C14H24N2O4/c1-10(2)15-14(18)12-9-20-6-4-16(12)7-13(17)11-3-5-19-8-11/h10-12H,3-9H2,1-2H3,(H,15,18) |
| InChIKey | CVHNJRUOCFYPQV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |