C14H28N4O3 — CID 83105862
4-(6-hydrazinyl-6-oxohexyl)-N-propan-2-ylmorpholine-3-carboxamide (PubChem CID 83105862) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-(6-hydrazinyl-6-oxohexyl)-N-propan-2-ylmorpholine-3-carboxamide.
| Compound Name | 4-(6-hydrazinyl-6-oxohexyl)-N-propan-2-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83105862 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 4-(6-hydrazinyl-6-oxohexyl)-N-propan-2-ylmorpholine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1COCCN1CCCCCC(=O)NN |
| InChI | InChI=1S/C14H28N4O3/c1-11(2)16-14(20)12-10-21-9-8-18(12)7-5-3-4-6-13(19)17-15/h11-12H,3-10,15H2,1-2H3,(H,16,20)(H,17,19) |
| InChIKey | LDGWWAJWDCGQSJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|