C15H17NO5S — CID 26948982
(2,2-dimethyl-3H-1-benzofuran-7-yl) 3,5-dimethyl-1,2-oxazole-4-sulfonate (PubChem CID 26948982) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) 3,5-dimethyl-1,2-oxazole-4-sulfonate.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) 3,5-dimethyl-1,2-oxazole-4-sulfonate |
|---|---|
| PubChem CID | 26948982 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) 3,5-dimethyl-1,2-oxazole-4-sulfonate |
| SMILES | Cc1noc(C)c1S(=O)(=O)Oc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C15H17NO5S/c1-9-14(10(2)20-16-9)22(17,18)21-12-7-5-6-11-8-15(3,4)19-13(11)12/h5-7H,8H2,1-4H3 |
| InChIKey | UZUNOHQEAJUVGR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|