C9H3BrClF3N2O — CID 115112406
3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1,2-oxazol-5-amine (PubChem CID 115112406) has the molecular formula C9H3BrClF3N2O and a molecular weight of 327.49 g/mol. Its IUPAC name is 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 115112406 |
| Molecular Formula | C9H3BrClF3N2O |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2c(F)c(F)c(Cl)c(F)c2Br)no1 |
| InChI | InChI=1S/C9H3BrClF3N2O/c10-5-4(2-1-3(15)17-16-2)7(12)9(14)6(11)8(5)13/h1H,15H2 |
| InChIKey | CPXQSBUXVYCUNU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|