C10H6BrClF3N3 — CID 115112019
3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1-methylpyrazol-5-amine (PubChem CID 115112019) has the molecular formula C10H6BrClF3N3 and a molecular weight of 340.53 g/mol. Its IUPAC name is 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1-methylpyrazol-5-amine.
| Compound Name | 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 115112019 |
| Molecular Formula | C10H6BrClF3N3 |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | 3-(2-bromo-4-chloro-3,5,6-trifluorophenyl)-1-methylpyrazol-5-amine |
| SMILES | Cn1nc(-c2c(F)c(F)c(Cl)c(F)c2Br)cc1N |
| InChI | InChI=1S/C10H6BrClF3N3/c1-18-4(16)2-3(17-18)5-6(11)9(14)7(12)10(15)8(5)13/h2H,16H2,1H3 |
| InChIKey | SYDCETAKGJLSRQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|