C11H14N4O — CID 115112711
5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,3-dimethylaniline (PubChem CID 115112711) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,3-dimethylaniline.
| Compound Name | 5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 115112711 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,3-dimethylaniline |
| SMILES | Cc1cc(-c2noc(CN)n2)cc(N)c1C |
| InChI | InChI=1S/C11H14N4O/c1-6-3-8(4-9(13)7(6)2)11-14-10(5-12)16-15-11/h3-4H,5,12-13H2,1-2H3 |
| InChIKey | ZYOGACLMTSQAJS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|