C9H9ClN4O — CID 115112709
5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2-chloroaniline (PubChem CID 115112709) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2-chloroaniline.
| Compound Name | 5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2-chloroaniline |
|---|---|
| PubChem CID | 115112709 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 5-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2-chloroaniline |
| SMILES | NCc1nc(-c2ccc(Cl)c(N)c2)no1 |
| InChI | InChI=1S/C9H9ClN4O/c10-6-2-1-5(3-7(6)12)9-13-8(4-11)15-14-9/h1-3H,4,11-12H2 |
| InChIKey | AWYWABSGKNLBHY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|