C15H11Cl2N3O — CID 81494264
2-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 81494264) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | 2-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 81494264 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | Nc1ccccc1Cc1nc(-c2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C15H11Cl2N3O/c16-11-6-5-10(7-12(11)17)15-19-14(21-20-15)8-9-3-1-2-4-13(9)18/h1-7H,8,18H2 |
| InChIKey | XLGFCHRWCABZSH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|