C12H13N3O — CID 62536508
2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]aniline (PubChem CID 62536508) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]aniline.
| Compound Name | 2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 62536508 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]aniline |
| SMILES | Nc1ccccc1Cc1nc(C2CC2)no1 |
| InChI | InChI=1S/C12H13N3O/c13-10-4-2-1-3-9(10)7-11-14-12(15-16-11)8-5-6-8/h1-4,8H,5-7,13H2 |
| InChIKey | XZNFYYDIYVMKNU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|