C15H19N3OS — CID 107273796
2-[2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline (PubChem CID 107273796) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline.
| Compound Name | 2-[2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline |
|---|---|
| PubChem CID | 107273796 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[2-[3-(thian-2-yl)-1,2,4-oxadiazol-5-yl]ethyl]aniline |
| SMILES | Nc1ccccc1CCc1nc(C2CCCCS2)no1 |
| InChI | InChI=1S/C15H19N3OS/c16-12-6-2-1-5-11(12)8-9-14-17-15(18-19-14)13-7-3-4-10-20-13/h1-2,5-6,13H,3-4,7-10,16H2 |
| InChIKey | IZTFVJJFXHGANI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|