C12H10Cl2N2O — CID 154748359
3-cyclopropyl-5-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazole (PubChem CID 154748359) has the molecular formula C12H10Cl2N2O and a molecular weight of 269.13 g/mol. Its IUPAC name is 3-cyclopropyl-5-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-cyclopropyl-5-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 154748359 |
| Molecular Formula | C12H10Cl2N2O |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 3-cyclopropyl-5-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazole |
| SMILES | Clc1ccc(Cc2nc(C3CC3)no2)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O/c13-9-4-3-8(10(14)6-9)5-11-15-12(16-17-11)7-1-2-7/h3-4,6-7H,1-2,5H2 |
| InChIKey | MHALBYWHYMLBHR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |