C10H5Cl2N3OS — CID 91320388
[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl thiocyanate (PubChem CID 91320388) has the molecular formula C10H5Cl2N3OS and a molecular weight of 286.14 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl thiocyanate.
| Compound Name | [3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 91320388 |
| Molecular Formula | C10H5Cl2N3OS |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methyl thiocyanate |
| SMILES | N#CSCc1nc(-c2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C10H5Cl2N3OS/c11-7-2-1-6(3-8(7)12)10-14-9(16-15-10)4-17-5-13/h1-3H,4H2 |
| InChIKey | KXHFLXXILLYFKI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|