C15H8F3NO3 — CID 115113980
2-[4-(trifluoromethyl)-1-benzofuran-2-yl]pyridine-4-carboxylic acid (PubChem CID 115113980) has the molecular formula C15H8F3NO3 and a molecular weight of 307.23 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)-1-benzofuran-2-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[4-(trifluoromethyl)-1-benzofuran-2-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 115113980 |
| Molecular Formula | C15H8F3NO3 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[4-(trifluoromethyl)-1-benzofuran-2-yl]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2cc3c(C(F)(F)F)cccc3o2)c1 |
| InChI | InChI=1S/C15H8F3NO3/c16-15(17,18)10-2-1-3-12-9(10)7-13(22-12)11-6-8(14(20)21)4-5-19-11/h1-7H,(H,20,21) |
| InChIKey | RXNBRZKLRPMGCY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |