C16H14F3N3 — CID 115114017
[2-[1-methyl-4-(trifluoromethyl)indol-2-yl]-4-pyridinyl]methanamine (PubChem CID 115114017) has the molecular formula C16H14F3N3 and a molecular weight of 305.30 g/mol. Its IUPAC name is [2-[1-methyl-4-(trifluoromethyl)indol-2-yl]-4-pyridinyl]methanamine.
| Compound Name | [2-[1-methyl-4-(trifluoromethyl)indol-2-yl]-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 115114017 |
| Molecular Formula | C16H14F3N3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | [2-[1-methyl-4-(trifluoromethyl)indol-2-yl]-4-pyridinyl]methanamine |
| SMILES | Cn1c(-c2cc(CN)ccn2)cc2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C16H14F3N3/c1-22-14-4-2-3-12(16(17,18)19)11(14)8-15(22)13-7-10(9-20)5-6-21-13/h2-8H,9,20H2,1H3 |
| InChIKey | DFLAPIICQASFMK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |