C15H21N3O — CID 115115941
2-cyano-N-(2,2,4-trimethylpentyl)pyridine-4-carboxamide (PubChem CID 115115941) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-cyano-N-(2,2,4-trimethylpentyl)pyridine-4-carboxamide.
| Compound Name | 2-cyano-N-(2,2,4-trimethylpentyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115115941 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-cyano-N-(2,2,4-trimethylpentyl)pyridine-4-carboxamide |
| SMILES | CC(C)CC(C)(C)CNC(=O)c1ccnc(C#N)c1 |
| InChI | InChI=1S/C15H21N3O/c1-11(2)8-15(3,4)10-18-14(19)12-5-6-17-13(7-12)9-16/h5-7,11H,8,10H2,1-4H3,(H,18,19) |
| InChIKey | FKEDQPQONAPCRA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |