C17H28N2 — CID 115118553
N-[2-(2,5-dimethylphenyl)-2-methylpropyl]piperidin-4-amine (PubChem CID 115118553) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-[2-(2,5-dimethylphenyl)-2-methylpropyl]piperidin-4-amine.
| Compound Name | N-[2-(2,5-dimethylphenyl)-2-methylpropyl]piperidin-4-amine |
|---|---|
| PubChem CID | 115118553 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-[2-(2,5-dimethylphenyl)-2-methylpropyl]piperidin-4-amine |
| SMILES | Cc1ccc(C)c(C(C)(C)CNC2CCNCC2)c1 |
| InChI | InChI=1S/C17H28N2/c1-13-5-6-14(2)16(11-13)17(3,4)12-19-15-7-9-18-10-8-15/h5-6,11,15,18-19H,7-10,12H2,1-4H3 |
| InChIKey | OAHGKSHTRGHJPL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |