C9H22N4 — CID 115119475
3-N-(1-methylpiperidin-3-yl)propane-1,2,3-triamine (PubChem CID 115119475) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-N-(1-methylpiperidin-3-yl)propane-1,2,3-triamine.
| Compound Name | 3-N-(1-methylpiperidin-3-yl)propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119475 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 3-N-(1-methylpiperidin-3-yl)propane-1,2,3-triamine |
| SMILES | CN1CCCC(NCC(N)CN)C1 |
| InChI | InChI=1S/C9H22N4/c1-13-4-2-3-9(7-13)12-6-8(11)5-10/h8-9,12H,2-7,10-11H2,1H3 |
| InChIKey | ASCWWLCPMLFGIY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |