C10H20N2O3 — CID 115122911
3-hydroxy-4-[(1-methylpiperidin-3-yl)amino]butanoic acid (PubChem CID 115122911) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-hydroxy-4-[(1-methylpiperidin-3-yl)amino]butanoic acid.
| Compound Name | 3-hydroxy-4-[(1-methylpiperidin-3-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 115122911 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-hydroxy-4-[(1-methylpiperidin-3-yl)amino]butanoic acid |
| SMILES | CN1CCCC(NCC(O)CC(=O)O)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-12-4-2-3-8(7-12)11-6-9(13)5-10(14)15/h8-9,11,13H,2-7H2,1H3,(H,14,15) |
| InChIKey | GHBQDXPCTYQEOM-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |