C7H19N3 — CID 115119484
3-N-methyl-3-N-propan-2-ylpropane-1,2,3-triamine (PubChem CID 115119484) has the molecular formula C7H19N3 and a molecular weight of 145.25 g/mol. Its IUPAC name is 3-N-methyl-3-N-propan-2-ylpropane-1,2,3-triamine.
| Compound Name | 3-N-methyl-3-N-propan-2-ylpropane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119484 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | 3-N-methyl-3-N-propan-2-ylpropane-1,2,3-triamine |
| SMILES | CC(C)N(C)CC(N)CN |
| InChI | InChI=1S/C7H19N3/c1-6(2)10(3)5-7(9)4-8/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | NYETXHIBJVQLOI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |