C10H16FN3 — CID 115119608
3-N-(2-fluorophenyl)-3-N-methylpropane-1,2,3-triamine (PubChem CID 115119608) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-N-(2-fluorophenyl)-3-N-methylpropane-1,2,3-triamine.
| Compound Name | 3-N-(2-fluorophenyl)-3-N-methylpropane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119608 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 3-N-(2-fluorophenyl)-3-N-methylpropane-1,2,3-triamine |
| SMILES | CN(CC(N)CN)c1ccccc1F |
| InChI | InChI=1S/C10H16FN3/c1-14(7-8(13)6-12)10-5-3-2-4-9(10)11/h2-5,8H,6-7,12-13H2,1H3 |
| InChIKey | RGXQCRXGDNKHCU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |