C12H17N3O3 — CID 115120302
6-amino-4-(2-amino-3-hydroxypropyl)-2-methyl-1,4-benzoxazin-3-one (PubChem CID 115120302) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 6-amino-4-(2-amino-3-hydroxypropyl)-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-4-(2-amino-3-hydroxypropyl)-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115120302 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 6-amino-4-(2-amino-3-hydroxypropyl)-2-methyl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(N)cc2N(CC(N)CO)C1=O |
| InChI | InChI=1S/C12H17N3O3/c1-7-12(17)15(5-9(14)6-16)10-4-8(13)2-3-11(10)18-7/h2-4,7,9,16H,5-6,13-14H2,1H3 |
| InChIKey | KJEXCYDYOLNPFG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|