C13H19N3O2 — CID 115197702
6-amino-2-methyl-4-[3-(methylamino)propyl]-1,4-benzoxazin-3-one (PubChem CID 115197702) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-amino-2-methyl-4-[3-(methylamino)propyl]-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-2-methyl-4-[3-(methylamino)propyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115197702 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 6-amino-2-methyl-4-[3-(methylamino)propyl]-1,4-benzoxazin-3-one |
| SMILES | CNCCCN1C(=O)C(C)Oc2ccc(N)cc21 |
| InChI | InChI=1S/C13H19N3O2/c1-9-13(17)16(7-3-6-15-2)11-8-10(14)4-5-12(11)18-9/h4-5,8-9,15H,3,6-7,14H2,1-2H3 |
| InChIKey | SVWUNMFWIAPKQR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|