C10H14ClFN2O — CID 115121269
1-amino-3-(5-chloro-2-fluoro-N-methylanilino)propan-2-ol (PubChem CID 115121269) has the molecular formula C10H14ClFN2O and a molecular weight of 232.69 g/mol. Its IUPAC name is 1-amino-3-(5-chloro-2-fluoro-N-methylanilino)propan-2-ol.
| Compound Name | 1-amino-3-(5-chloro-2-fluoro-N-methylanilino)propan-2-ol |
|---|---|
| PubChem CID | 115121269 |
| Molecular Formula | C10H14ClFN2O |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-amino-3-(5-chloro-2-fluoro-N-methylanilino)propan-2-ol |
| SMILES | CN(CC(O)CN)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H14ClFN2O/c1-14(6-8(15)5-13)10-4-7(11)2-3-9(10)12/h2-4,8,15H,5-6,13H2,1H3 |
| InChIKey | VQXOGXNRYZGDQR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |