C11H16F2N2O — CID 117039096
4-amino-1-(3,4-difluoro-N-methylanilino)butan-2-ol (PubChem CID 117039096) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-amino-1-(3,4-difluoro-N-methylanilino)butan-2-ol.
| Compound Name | 4-amino-1-(3,4-difluoro-N-methylanilino)butan-2-ol |
|---|---|
| PubChem CID | 117039096 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-amino-1-(3,4-difluoro-N-methylanilino)butan-2-ol |
| SMILES | CN(CC(O)CCN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H16F2N2O/c1-15(7-9(16)4-5-14)8-2-3-10(12)11(13)6-8/h2-3,6,9,16H,4-5,7,14H2,1H3 |
| InChIKey | OXWNHLJMRIIVEK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |