C12H18F2N2 — CID 115134569
3-N-(3,4-difluorophenyl)-3-N,3-dimethylbutane-1,3-diamine (PubChem CID 115134569) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-N-(3,4-difluorophenyl)-3-N,3-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(3,4-difluorophenyl)-3-N,3-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115134569 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-N-(3,4-difluorophenyl)-3-N,3-dimethylbutane-1,3-diamine |
| SMILES | CN(c1ccc(F)c(F)c1)C(C)(C)CCN |
| InChI | InChI=1S/C12H18F2N2/c1-12(2,6-7-15)16(3)9-4-5-10(13)11(14)8-9/h4-5,8H,6-7,15H2,1-3H3 |
| InChIKey | NYSNLERFTJRCFR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |