C12H19ClN2 — CID 115134535
3-N-(4-chlorophenyl)-3-N,3-dimethylbutane-1,3-diamine (PubChem CID 115134535) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 3-N-(4-chlorophenyl)-3-N,3-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(4-chlorophenyl)-3-N,3-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115134535 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-N-(4-chlorophenyl)-3-N,3-dimethylbutane-1,3-diamine |
| SMILES | CN(c1ccc(Cl)cc1)C(C)(C)CCN |
| InChI | InChI=1S/C12H19ClN2/c1-12(2,8-9-14)15(3)11-6-4-10(13)5-7-11/h4-7H,8-9,14H2,1-3H3 |
| InChIKey | OYEWNWBSDFCBSE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |