C13H20F2N2 — CID 115204315
N-(3,4-difluorophenyl)-N,2,2-trimethylbutane-1,4-diamine (PubChem CID 115204315) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N,2,2-trimethylbutane-1,4-diamine.
| Compound Name | N-(3,4-difluorophenyl)-N,2,2-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115204315 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-(3,4-difluorophenyl)-N,2,2-trimethylbutane-1,4-diamine |
| SMILES | CN(CC(C)(C)CCN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H20F2N2/c1-13(2,6-7-16)9-17(3)10-4-5-11(14)12(15)8-10/h4-5,8H,6-7,9,16H2,1-3H3 |
| InChIKey | IFFPILKPYGWFKG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |