C15H26N2 — CID 115204284
N-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine (PubChem CID 115204284) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine.
| Compound Name | N-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115204284 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N,2,2-trimethylbutane-1,4-diamine |
| SMILES | Cc1ccc(C)c(N(C)CC(C)(C)CCN)c1 |
| InChI | InChI=1S/C15H26N2/c1-12-6-7-13(2)14(10-12)17(5)11-15(3,4)8-9-16/h6-7,10H,8-9,11,16H2,1-5H3 |
| InChIKey | REHWITNAOALBJJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |