C12H16FNO3 — CID 115122614
5-(4-fluoro-N-methylanilino)-4-hydroxypentanoic acid (PubChem CID 115122614) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is 5-(4-fluoro-N-methylanilino)-4-hydroxypentanoic acid.
| Compound Name | 5-(4-fluoro-N-methylanilino)-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 115122614 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-(4-fluoro-N-methylanilino)-4-hydroxypentanoic acid |
| SMILES | CN(CC(O)CCC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FNO3/c1-14(8-11(15)6-7-12(16)17)10-4-2-9(13)3-5-10/h2-5,11,15H,6-8H2,1H3,(H,16,17) |
| InChIKey | YYFSWJYTSICDKL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |