C11H18N2O3 — CID 115123544
methyl 4-hydroxy-5-[methyl(1H-pyrrol-3-yl)amino]pentanoate (PubChem CID 115123544) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is methyl 4-hydroxy-5-[methyl(1H-pyrrol-3-yl)amino]pentanoate.
| Compound Name | methyl 4-hydroxy-5-[methyl(1H-pyrrol-3-yl)amino]pentanoate |
|---|---|
| PubChem CID | 115123544 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | methyl 4-hydroxy-5-[methyl(1H-pyrrol-3-yl)amino]pentanoate |
| SMILES | COC(=O)CCC(O)CN(C)c1cc[nH]c1 |
| InChI | InChI=1S/C11H18N2O3/c1-13(9-5-6-12-7-9)8-10(14)3-4-11(15)16-2/h5-7,10,12,14H,3-4,8H2,1-2H3 |
| InChIKey | PSIXVYOFOTYLMK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |