C10H16N2O3 — CID 115122693
4-hydroxy-5-(1H-pyrrol-2-ylmethylamino)pentanoic acid (PubChem CID 115122693) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-hydroxy-5-(1H-pyrrol-2-ylmethylamino)pentanoic acid.
| Compound Name | 4-hydroxy-5-(1H-pyrrol-2-ylmethylamino)pentanoic acid |
|---|---|
| PubChem CID | 115122693 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-hydroxy-5-(1H-pyrrol-2-ylmethylamino)pentanoic acid |
| SMILES | O=C(O)CCC(O)CNCc1ccc[nH]1 |
| InChI | InChI=1S/C10H16N2O3/c13-9(3-4-10(14)15)7-11-6-8-2-1-5-12-8/h1-2,5,9,11-13H,3-4,6-7H2,(H,14,15) |
| InChIKey | SFQSRYQCTYWONT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |