C26H21F9N2O — CID 11512292
1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]-2,3-dihydroindol-5-yl]propan-2-ol (PubChem CID 11512292) has the molecular formula C26H21F9N2O and a molecular weight of 548.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]-2,3-dihydroindol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]-2,3-dihydroindol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 11512292 |
| Molecular Formula | C26H21F9N2O |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-methyl-1-[[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]-2,3-dihydroindol-5-yl]propan-2-ol |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)ccc1CN1c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2CC1C |
| InChI | InChI=1S/C26H21F9N2O/c1-14-11-18-12-20(23(38,25(30,31)32)26(33,34)35)8-10-22(18)37(14)13-17-5-9-21(36-15(17)2)16-3-6-19(7-4-16)24(27,28)29/h3-10,12,14,38H,11,13H2,1-2H3 |
| InChIKey | UDORIVMXMIDSDV-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|