C23H34N2O — CID 129188464
[1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol (PubChem CID 129188464) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is [1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol.
| Compound Name | [1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol |
|---|---|
| PubChem CID | 129188464 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | [1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-2-yl]methanol |
| SMILES | CC(C)C1CCC(N2CCC(n3c(CO)cc4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C23H34N2O/c1-17(2)18-7-9-20(10-8-18)24-13-11-21(12-14-24)25-22(16-26)15-19-5-3-4-6-23(19)25/h3-6,15,17-18,20-21,26H,7-14,16H2,1-2H3 |
| InChIKey | MNCLQFXBMWGDDJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |